| Identification | |
| Name: | 2-Propanone, 1-hydroxy- |
| Synonyms: | 2-Propanone,hydroxy- (6CI);1-Hydroxy-2-propanone;2-Oxopropanol;Acetol;Acetone alcohol;Acetylcarbinol;Acetylmethanol;Hydroxymethyl methyl ketone;Hydroxypropanone;Methanol, acetyl-;NSC 102497;Rongal 5242;a-Hydroxyacetone; |
| CAS: | 116-09-6 |
| EINECS: | 204-124-8 |
| Molecular Formula: | C3H6O2 |
| Molecular Weight: | 74.08 |
| InChI: | InChI=1/C3H6O2/c1-3(5)2-4/h4H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1224 |
| Density: | 1.082 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents, strong acids. Protect from moisture - hygroscopic. |
| Refractive index: | 1.425 |
| Solubility: | Very soluble |
| Appearance: | colorless to yellow liquid. |
| Specification: | colourless to yellow liquid Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| Packinggroup: | III |
| HS Code: | 29144090 |
| Sensitive: | Hygroscopic |
| Safety Data | |
 |
|
