| Identification | |
| Name: | Ethene,1,1,2,2-tetrafluoro- |
| Synonyms: | Ethene,tetrafluoro- (9CI);Ethylene, tetrafluoro- (6CI,8CI);1,1,2,2-Tetrafluoroethylene;Ethylene tetrafluoride;Lubron 5;PFC 1114;Perfluoroethene;Perfluoroethylene;R 1114;TFE;Teflon 851K02730;Tetrafluoroethene;Tetrafluoroethylene; |
| CAS: | 116-14-3 |
| EINECS: | 204-126-9 |
| Molecular Formula: | C2F4 |
| Molecular Weight: | 100.02 |
| InChI: | InChI=1/C2F4/c3-1(4)2(5)6 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1081 |
| Melting Point: | -142 ºC |
| Flash Point: | °C |
| Boiling Point: | -76.3 ºC |
| Density: | 1.1507 |
| Stability: | Stable. Reactive when heated. |
| Refractive index: | 1.241 |
| Solubility: | Insoluble |
| Appearance: | colourless gas |
| Specification: | colourless gas Safety Statements:16-36/37/39-45 16:Keep away from sources of ignition - No smoking 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | O52 |
| Flash Point: | °C |
| Storage Temperature: | Cylinders containing tetrafluoroethylene under high pressure.Should be stored in a cool, well-ventilated area and protected against accidental impacts store in a cool, dry, well-ventilated location. Separate from oxidizing materials, air, sulfur trioxide, halogen compounds. Outside or detached storage is preferred. |
| Color: | COLORLESS GAS |
| Usage: | In prepn of propellants for food product aerosols. |
| Safety Data | |
| Hazard Symbols | |
 |
|
