| Identification | |
| Name: | Methyl dichloroacetate |
| Synonyms: | Dichloroacetic acid methyl ester |
| CAS: | 116-54-1 |
| EINECS: | 204-146-8 |
| Molecular Formula: | C3H4Cl2O2 |
| Molecular Weight: | 142.97 |
| InChI: | InChI=1/C3H4Cl2O2/c1-7-3(6)2(4)5/h2H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2299 |
| Density: | 1.381 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4411-1.4431 |
| Water Solubility: | Slightly soluble |
| Solubility: | 141-145 oC |
| Appearance: | A colorless liquid with an ethereal odor. |
| Packinggroup: | III |
| HS Code: | 29154000 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Usage: | Used to make other chemicals. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
