| Identification | |
| Name: | 1-Amino-4-hydroxyanthraquinone |
| Synonyms: | 1-Amino-4-hydroxyanthraguinone; Disperse Red 15 |
| CAS: | 116-85-8 |
| EINECS: | 204-163-0 |
| Molecular Formula: | C14H9NO3 |
| Molecular Weight: | 239.23 |
| InChI: | InChI=1/C14H9NO3/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-6,16H,15H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 262.7°C |
| Boiling Point: | 510.8°Cat760mmHg |
| Density: | 1.497g/cm3 |
| Refractive index: | 1.745 |
| Appearance: | deep purple to dark brown crystalline powder |
| Specification: | deep purple to dark brown crystalline powder Safety Statements:36/37-24/25 36/37:Wear suitable protective clothing and gloves 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 262.7°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
