Identification |
Name: | 2,4-Pentanedione,3-[(3,4-dihydroxy-5-nitrophenyl)methylene]- |
Synonyms: | Nitecapone;OR 462 |
CAS: | 116313-94-1 |
Molecular Formula: | C12H11 N O6 |
Molecular Weight: | 0 |
InChI: | InChI=1/C12H11NO6/c1-6(14)9(7(2)15)3-8-4-10(13(18)19)12(17)11(16)5-8/h3-5,16-17H,1-2H3 |
Molecular Structure: |
![(C12H11NO6) Nitecapone;OR 462](https://img1.guidechem.com/chem/e/dict/22/116313-94-1.jpg) |
Properties |
Flash Point: | 211.6°C |
Boiling Point: | 495.3°C at 760 mmHg |
Density: | 1.451g/cm3 |
Refractive index: | 1.645 |
Flash Point: | 211.6°C |
Usage: | Inhibitor for the treatment of Parkinson disease |
Safety Data |
|
![](/images/detail_15.png) |