| Identification | |
| Name: | Methanone,(4-chlorophenyl)(3,4-dimethoxyphenyl)- |
| Synonyms: | 3,4-Dimethoxy-4'-chloro-benzophenone |
| CAS: | 116412-83-0 |
| EINECS: | 404-610-1 |
| Molecular Formula: | C15H13 Cl O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C15H13ClO3/c1-18-13-8-5-11(9-14(13)19-2)15(17)10-3-6-12(16)7-4-10/h3-9H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 167.2°C |
| Boiling Point: | 414.5°Cat760mmHg |
| Density: | 1.216g/cm3 |
| Refractive index: | 1.566 |
| Specification: |
4-Chloro-3',4'-dimethoxybenzophenone , its cas register number is 116412-83-0. It also can be called Methanone,(4-chlorophenyl)(3,4-dimethoxyphenyl)- . |
| Flash Point: | 167.2°C |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
