| Identification | |
| Name: | 1H-Carbazol-3-amine,2,3,4,9-tetrahydro-, (3R)- |
| Synonyms: | 1H-Carbazol-3-amine,2,3,4,9-tetrahydro-, (R)-;(R)-1,2,3,4-Tetrahydrocarbazol-3-amine;(R)-3-Amino-1,2,3,4-tetrahydrocarbazole; |
| CAS: | 116650-33-0 |
| Molecular Formula: | C12H14N2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H14N2/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h1-4,8,14H,5-7,13H2/t8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.192 g/cm3 |
| Refractive index: | 1.677 |
| Specification: |
The (R)-3-amino-1,2,3,4-terahydrocarbazole, with the CAS registry number 116650-33-0, has the systematic name of 2,3,4,9-tetrahydro-1H-carbazol-3-amine. And it is also called1H-carbazol-3-amine, 2,3,4,9-tetrahydro-. The molecular formula of the chemical is C12H14N2. The characteristics of (R)-3-amino-1,2,3,4-terahydrocarbazole are as followings: (1)ACD/LogP: 1.71; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 2; (8)#H bond donors: 3; (9)#Freely Rotating Bonds: 1; (10)Polar Surface Area: 41.81 Å2; (11)Index of Refraction: 1.677; (12)Molar Refractivity: 58.868 cm3; (13)Molar Volume: 156.272 cm3; (14)Polarizability: 23.337×10-24cm3; (15)Surface Tension: 55.653 dyne/cm; (16)Density: 1.192 g/cm3; (17)Flash Point: 200.5 °C; (18)Enthalpy of Vaporization: 60.847 kJ/mol; (19)Boiling Point: 362.512 °C at 760 mmHg; (20)Vapour Pressure: 0 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
