| Identification | |
| Name: | 2H-Pyrrole,3,4-dihydro-3,3-dimethyl-5-(phenylmethyl)- |
| Synonyms: | 2-Benzyl-4,4-dimethyl-1-pyrroline;5-Benzyl-3,4-dihydro-3,3-dimethyl-2H-pyrrole; |
| CAS: | 116673-95-1 |
| Molecular Formula: | C13H17N |
| Molecular Weight: | 187.28 |
| InChI: | InChI=1/C13H17N/c1-13(2)9-12(14-10-13)8-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.96 |
| Refractive index: | 1.54 |
| Specification: |
The 5-Benzyl-3,4-dihydro-3,3-dimethyl-2H-pyrrole with the CAS number 116673-95-1 is also called 2H-Pyrrole,3,4-dihydro-3,3-dimethyl-5-(phenylmethyl)-. The systematic name is 5-benzyl-3,3-dimethyl-3,4-dihydro-2H-pyrrole. Its molecular formula is C13H17N. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 3.71; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 1; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 12.36Å2; (7)Index of Refraction: 1.54; (8)Molar Refractivity: 60.574 cm3; (9)Molar Volume: 193.131 cm3; (10)Polarizability: 24.014×10-24cm3; (11)Surface Tension: 33.978 dyne/cm; (12)Enthalpy of Vaporization: 48.922 kJ/mol; (13)Vapour Pressure: 0.011 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
