| Identification | |
| Name: | 2-Pyridinecarbonitrile,3-(bromomethyl)- |
| Synonyms: | 2-Cyano-3-(bromomethyl)pyridine;3-(Bromomethyl)-2-cyanopyridine;3-(Bromomethyl)-2-pyridinecarbonitrile; |
| CAS: | 116986-13-1 |
| Molecular Formula: | C7H5BrN2 |
| Molecular Weight: | 197.032 |
| InChI: | InChI=1/C7H5BrN2/c8-4-6-2-1-3-10-7(6)5-9/h1-3H,4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 308.2 °C at 760 mmHg |
| Boiling Point: | 308.2 °C at 760 mmHg |
| Density: | 1.6 g/cm3 |
| Refractive index: | 1.591 |
| Specification: |
The 3-(Bromomethyl)pyridine-2-carbonitrile, with the CAS registry number 116986-13-1, is also known as 2-Pyridinecarbonitrile, 3-(bromomethyl)-. It belongs to the product categories of Pyridine Series; Methyl Halides; Pyridines and Methyl Halides. This chemical's molecular formula is C7H5BrN2 and molecular weight is 197.03. What's more, its systematic name is called 3-(Bromomethyl)pyridine-2-carbonitrile. Physical properties about 3-(Bromomethyl)pyridine-2-carbonitrile are: (1) ACD/LogP: 1.21; (2) # of Rule of 5 Violations: 0; (3) ACD/LogD (pH 5.5): 1.21; (4) ACD/LogD (pH 7.4): 1.21; (5) ACD/BCF (pH 5.5): 4.91; (6) ACD/BCF (pH 7.4): 4.91; (7) ACD/KOC (pH 5.5): 108.77; (8) ACD/KOC (pH 7.4): 108.77; (9) #H bond acceptors: 2; (10)#H bond donors: 0; (11) #Freely Rotating Bonds: 1; (12) Polar Surface Area: 36.68 Å2; (13) Index of Refraction: 1.591; (14) Molar Refractivity: 41.47 cm3; (15) Molar Volume: 122.5 cm3; (16) Surface Tension: 58.9 dyne/cm; (17) Density: 1.6 g/cm3; (18) Flash Point: 140.2 °C; (19) Enthalpy of Vaporization: 54.89 kJ/mol; (20) Boiling Point: 308.2 °C at 760 mmHg; (21) Vapour Pressure: 0.00069 mmHg at 25 °C. You can still convert the following datas into molecular structure: |
| Flash Point: | 308.2 °C at 760 mmHg |
| Safety Data | |
 |
|
