| Identification | |
| Name: | 1,8-Dihydroxyanthraquinone |
| Synonyms: | Danthron; dantron; Chrysazine; 2-Amino-5-tert-butyl-1,3,4-thiadiazole |
| CAS: | 117-10-2 |
| EINECS: | 204-173-5 |
| Molecular Formula: | C14H8O4 |
| Molecular Weight: | 240.21 |
| InChI: | InChI=1/C14H8O4/c15-9-5-1-3-7-11(9)14(18)12-8(13(7)17)4-2-6-10(12)16/h1-6,15-16H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 232 |
| Density: | 1.54 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.787 (20 C) |
| Water Solubility: | insoluble |
| Solubility: | Insoluble (Soluble in glacial acetic acid, aqueous alkali, ethanol, acetone, chloroform and ether) |
| Appearance: | yellow to orange solid |
| Report: |
NTP 10th Report on Carcinogens. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29146990 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Red or red-yellow needles or leaves (from alcohol) Orange needles from alcohol Orange powder or reddish-brown needles |
| Usage: | Intermediate in the production of alizarin and indanthrene dyestuffs. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
