| Identification | |
| Name: | 9,10-Anthracenedione,1-amino-5-chloro- |
| Synonyms: | Anthraquinone,1-amino-5-chloro- (6CI,7CI,8CI);1-Amino-5-chloroanthraquinone;1-Chloro-5-aminoanthraquinone;5-Amino-1-chloroanthraquinone;5-Chloro-1-aminoanthraquinone;NSC 4996; |
| CAS: | 117-11-3 |
| EINECS: | 204-174-0 |
| Molecular Formula: | C14H8ClNO2 |
| Molecular Weight: | 257.67 |
| InChI: | InChI=1/C14H8ClNO2/c15-9-5-1-3-7-11(9)13(17)8-4-2-6-10(16)12(8)14(7)18/h1-6H,16H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 256.7°C |
| Boiling Point: | 500.9°Cat760mmHg |
| Density: | 1.486g/cm3 |
| Refractive index: | 1.711 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 256.7°C |
| Safety Data | |
 |
|
