| Identification | ||
| Name: | 9,10-Anthracenedione,1,5-dihydroxy- | |
| Synonyms: | Anthraquinone,1,5-dihydroxy- (8CI);Anthrarufin (6CI);1,5-Dihydroxy-9,10-anthraquinone;NSC 646570;NSC 7211; | |
| CAS: | 117-12-4 | |
| EINECS: | 204-175-6 | |
| Molecular Formula: | C14H8O4 | |
| Molecular Weight: | 240.21 | |
| InChI: | InChI=1/C14H8O4/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6,15-16H | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 25kgs | |
| Density: | 1.54 g/cm3 | |
| Refractive index: | 1.732 | |
| Water Solubility: | Slightly soluble AUTOIGNITION | |
| Solubility: | Slightly soluble AUTOIGNITION | |
| Appearance: | orange or red crystaline powder | |
| Specification: | Yellow to Green Solid Safety Statements:26-37/39-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 36/37:Wear suitable protective clothing and gloves | |
| Report: |
Reported in EPA TSCA Inventory. | |
| Storage Temperature: | -20?C Freezer | |
| Safety Data | ||
| Hazard Symbols | ||
 |
||
