| Identification |
| Name: | 2,3-Dichloro-1,4-naphthoquinone |
| Synonyms: | aurora ka-5010; dichloronaphthoquinone; dichlon; 'lgc' (1114); 2,3-dichloro-1,4-naphthalenedione; 2,3-dichloro-1,4-naphthaquinone; |
| CAS: | 117-80-6 |
| EINECS: | 204-210-5 |
| Molecular Formula: | C10H4Cl2O2 |
| Molecular Weight: | 227.05 |
| InChI: | InChI=1/C10H4Cl2O2/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2761/2811 |
| Flash Point: | 127.5°C |
| Density: | 1.54g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.634 |
| Water Solubility: | 0.008 g/L |
| Solubility: | insoluble |
| Appearance: | yellow crystalline powder |
| Packinggroup: | III |
| HS Code: | 29147090 |
| Flash Point: | 127.5°C |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Color: | Golden yellow needles or leaflets from alcohol. |
| Usage: | Seed disinfectant, fungicide for foliage and textiles, insecticide, organic catalyst. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
| |
 |
