| Identification | |
| Name: | Quinolinium,2-[2-[4-(dimethylamino)phenyl]ethenyl]-1-ethyl-, iodide (1:1) |
| Synonyms: | 2-[p-(Dimethylamino)styryl]-1-ethylquinoliniumiodide (7CI);Quinaldine Red (6CI);Quinolinium,2-[2-[4-(dimethylamino)phenyl]ethenyl]-1-ethyl-, iodide (9CI);Quinolinium,2-[p-(dimethylamino)styryl]-1-ethyl-, iodide (8CI);1-Ethyl-2-(p-dimethylaminostyryl)quinoline iodide;2-(p-Dimethylaminostyryl)quinoline ethiodide;2-[4-(Dimethylamino)styryl]-1-ethylquinoliniumiodide;Eastman 1361;a-(p-Dimethylaminophenylethylene)quinoline ethiodide; |
| CAS: | 117-92-0 |
| EINECS: | 204-221-5 |
| Molecular Formula: | C21H23IN2 |
| Molecular Weight: | 430.33 |
| InChI: | InChI=1/C21H23N2.HI/c1-4-23-20(16-12-18-7-5-6-8-21(18)23)15-11-17-9-13-19(14-10-17)22(2)3;/h5-16H,4H2,1-3H3;1H/q+1;/p-1 |
| Molecular Structure: | ![(C21H23IN2) 2-[p-(Dimethylamino)styryl]-1-ethylquinoliniumiodide (7CI);Quinaldine Red (6CI);Quinolinium,2-[2-[4-...](https://img1.guidechem.com/chem/e/dict/208/117-92-0.jpg) |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Stability: | No data. |
| Water Solubility: | almost insoluble |
| Solubility: | almost insoluble in water |
| Appearance: | Greenish-black powder |
| Specification: | greenish-black or dark blue to grey powder Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Packinggroup: | II; III |
| HS Code: | 29334990 |
| Flash Point: | °C |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Used as a chemical indicator. |
| Safety Data | |
 |
|
