| Identification | |
| Name: | Propanoic acid,2-(4-aminophenoxy)-2-methyl- |
| Synonyms: | 2-(4-Aminophenoxy)-2-methylpropionicacid; |
| CAS: | 117011-70-8 |
| Molecular Formula: | C10H13NO3 |
| Molecular Weight: | 195.21 |
| InChI: | InChI=1/C10H13NO3/c1-10(2,9(12)13)14-8-5-3-7(11)4-6-8/h3-6H,11H2,1-2H3,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.22 g/cm3 |
| Refractive index: | 1.571 |
| Specification: |
2-(4-Aminophenoxy)-2-methylpropionic acid is the IUPAC name of this product. With the CAS registry number 117011-70-8, 2-(4-Aminophenoxy)-2-methylpropionic acid is also named as 2-(4-Aminophenoxy)-2-methylpropanoic acid ; 2-(4-Aminophenoxy)-2-methylpropanoicacid ; 2-(4-Amino-phenoxy)-2-methyl-propionic acid ; propanoic acid, 2-(4-aminophenoxy)-2-methyl- . The product categories of 2-(4-Aminophenoxy)-2-methylpropionic acid is pharmacetical. People can use the following data to convert to the molecule structure. SMILES: O=C(O)C(Oc1ccc(cc1)N)(C)C; InChI:InChI=1/C10H13NO3/c1-10(2,9(12)13)14-8-5-3-7(11)4-6-8/h3-6H,11H2,1-2H3,(H,12,13). |
| Safety Data | |
 |
|
