| Identification |
| Name: | 1,3-Cyclobutanedicarboxylicacid, 1-amino-, trans- |
| Synonyms: | 2,4-methanoglutamate;3-cyclobutanedicarboxylicacid,1-amino-trans-hydrate;trans-1-aminocyclobutane-1,3-dicarboxylicacidhydrate;CIS-ACBD;CIS-1-AMINOCYCLOBUTANE-1,3-DICARBOXYLIC ACID;CIS-2,4-METHANOGLUTAMIC ACID;1-AMINOCYCLOBUTANE-CIS-1,3-DICARBOXYLIC ACID;1-AMINOCYCLOBUTANE-CIS-1,3-DICARBOXYLIC ACID MONOHYDRATE |
| CAS: | 117488-23-0 |
| Molecular Formula: | C6H9 N O4 |
| Molecular Weight: | 159.14 |
| InChI: | InChI=1/C6H9NO4/c7-6(5(10)11)1-3(2-6)4(8)9/h3H,1-2,7H2,(H,8,9)(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 128°C |
| Boiling Point: | 288.1°Cat760mmHg |
| Density: | 1.568g/cm3 |
| Refractive index: | 1.587 |
| Biological Activity: | Very potent and selective NMDA agonist. Certain confusion exists over the naming of this compound because of apparent contradictions in the literature. This is the isomer which has the carboyxlic acid and the amino groups on opposite sides of the cyclobutyl ring. |
| Flash Point: | 128°C |
| Safety Data |
| |
 |
