| Identification | |
| Name: | Phenyltoloxamine citrate |
| Synonyms: | Phenyltoloxamine dihydrogen citrate;Kutrase;Phenoxadrine citrate;Ethylamine, N, N-dimethyl-2-[ (.alpha.-phenyl-o-tolyl)oxy]-, citrate (1:1);Ethanamine, N,N-dimethyl-2-(2-(phenylmethyl)phenoxy)-, 2-hydroxy-1,2,3-propanetricarboxylate (1:1);Phenoxadrin citrate;Mobigesic;Ethanamine,N,N-dimethyl-2-[2-(phenylmethyl) phenoxy]-,2-hydroxy-1,2,3- propanetricarboxylate (1:1);2-(2-benzylphenoxy)ethyl-dimethyl-azanium; 3-carboxy-3,5-dihydroxy-5-oxo-pentanoate;Floxamine; |
| CAS: | 1176-08-5 |
| EINECS: | 214-644-7 |
| Molecular Formula: | C17H21NO.C6H8O7 |
| Molecular Weight: | 447.53 |
| InChI: | InChI=1/C17H21NO.C6H8O7/c1-18(2)12-13-19-17-11-7-6-10-16(17)14-15-8-4-3-5-9-15;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-11H,12-14H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Appearance: | White powder |
| Specification: |
Phenyltoloxamine citrate ,its cas register number is 1176-08-5. It also can be called Ethanamine, N,N-dimethyl-2-[2- (phenylmethyl)phenoxy]-, 2-hydroxy-1,2,3-propanetricarboxylate (1:1) ; Floxamine ; N,N-Dimethyl-2-(alpha-phenyl-o-toloxy)ethylamine dihydrogen citrate ; N,N-Dimethyl-2-(.alpha.-phenyl-o-toloxy)ethylamine dihydrogen citrate ; Phenoxadrine citrate and N,N-Dimethyl-2-(a-phenyl-o-toloxy)ethylamine Citrate (1:1) . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
