| Identification | |
| Name: | 1,3-Benzenediol,2,4-dinitroso- |
| Synonyms: | Resorcinol,2,4-dinitroso- (6CI,7CI,8CI); 1,3-Dihydroxy-2,4-dinitrosobenzene;2,4-Dinitroso-1,3-dihydroxybenzene; 2,4-Dinitrosoresorcinol; NSC 1541; Rezad 33 |
| CAS: | 118-02-5 |
| EINECS: | 204-228-3 |
| Molecular Formula: | C6H4 N2 O4 |
| Molecular Weight: | 168.12 |
| InChI: | InChI=1/C6H4N2O4/c9-4-2-1-3(7-11)6(10)5(4)8-12/h1-2,9-10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 41526 |
| Melting Point: | 168 |
| Flash Point: | 225.8°C |
| Boiling Point: | 449.8°Cat760mmHg |
| Density: | 1.69g/cm3 |
| Refractive index: | 1.672 |
| Specification: |
2,4-Dinitrosoresorcinol ,its cas register number is 118-02-5. It also can be called Benzene-1,3-diol, 2,4-dinitroso- ; and 2,4-Dinitroso-m-resorcinol . |
| Packinggroup: | O52 |
| Flash Point: | 225.8°C |
| Safety Data | |
 |
|
