Identification |
Name: | 1(3H)-Isobenzofuranone,6,7-dimethoxy-3-[(5R)-5,6,7,8-tetrahydro-6-methyl-1,3-dioxolo[4,5-g]isoquinolin-5-yl]-,(3S)- |
Synonyms: | 1(3H)-Isobenzofuranone,6,7-dimethoxy-3-(5,6,7,8-tetrahydro-6-methyl-1,3-dioxolo[4,5-g]isoquinolin-5-yl)-,[S-(R*,S*)]-; Hydrastine (8CI); 1,3-Dioxolo[4,5-g]isoquinoline,1(3H)-isobenzofuranone deriv.; (-)-Hydrastine; (-)-b-Hydrastine; (1R,9S)-b-Hydrastine; l-Hydrastine; b-Hydrastine |
CAS: | 118-08-1 |
EINECS: | 204-233-0 |
Molecular Formula: | C21H21 N O6 |
Molecular Weight: | 383.39 |
InChI: | InChI=1/C21H21NO6/c1-22-7-6-11-8-15-16(27-10-26-15)9-13(11)18(22)19-12-4-5-14(24-2)20(25-3)17(12)21(23)28-19/h4-5,8-9,18-19H,6-7,10H2,1-3H3/t18-,19-/m1/s1 |
Molecular Structure: |
|
Properties |
Transport: | 1544 |
Flash Point: | 285.7°C |
Boiling Point: | 548.8°Cat760mmHg |
Density: | 1.339g/cm3 |
Refractive index: | 1.614 |
Specification: | usageEng:Inhibitor of Dopamine biosynthesis. Safety Statements:36 36:Wear suitable protective clothing |
Packinggroup: | III |
Flash Point: | 285.7°C |
Storage Temperature: | −20°C |
Usage: | Inhibitor of Dopamine biosynthesis. |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
|