| Identification | |
| Name: | 1-Naphthalenemethylamine |
| Synonyms: | 1-Naphthylmethylamine; 1-(Aminomethyl)naphthalene~1-Naphthylmethylamine; 1-Naphthylmethanamine |
| CAS: | 118-31-0 |
| EINECS: | 204-244-0 |
| Molecular Formula: | C11H11N |
| Molecular Weight: | 157.21 |
| InChI: | InChI=1/C11H11N/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8,12H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 |
| Flash Point: | 148.3°C |
| Density: | 1.073 |
| Refractive index: | 1.643 |
| Appearance: | Clear light yellow to yellow liquid |
| Specification: | Clear light yellow to yellow liquid Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 148.3°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
