| Identification | |
| Name: | 2-Naphthalenol,8-amino- |
| Synonyms: | NSC 7939;NSC 60277;2-Naphthol,8-amino- (7CI,8CI);1-Amino-7-hydroxynaphthalene;8-Amino-2-naphthol;7-Hydroxy-1-naphthylamine; |
| CAS: | 118-46-7 |
| EINECS: | 204-252-4 |
| Molecular Formula: | C10H9NO |
| Molecular Weight: | 159.18 |
| InChI: | InChI=1/C10H9NO/c11-10-3-1-2-7-4-5-8(12)6-9(7)10/h1-6,12H,11H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 182.6 ºC |
| Boiling Point: | 378.3 ºC at 760 mmHg |
| Density: | 1.281 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.741 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | Grey - brown powder. |
| Specification: |
8-Amino-2-naphthol with cas registry number of 118-46-7 is grey - brown powder, known as 1-Amino-7-hydroxynaphthalene ; 1-Amino-7-naphthol ; 3-13-00-01907 (Beilstein Handbook Reference) ; 7-Hydroxy-1-naphthylamine ; AI3-51302 ; NSC 60277 ; 2-Naphthalenol, 8-amino- ; 2-Naphthol, 8-amino- . It is incompatible with strong oxidizing agents. When heated to decomposition, it yields Nitrogen oxides, Carbon monoxide , Carbon dioxide . It is used for the preparation of azo dyes. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 182.6 ºC |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
