| Identification | |
| Name: | 2-Ethylhexyl salicylate |
| Synonyms: | Parsol EHS;Salicylic acid, 2-ethylhexyl ester;Solarom OS;Sunarome O;Sunarome WMO;Uvinul 0-18;2-Ethylhexylo-hydroxybenzoate;Dermoblock OS;Escalol 587;EusolexOS;NSC 46151;Neo Heliopan OS;Octisalate;Octyl salicylate; |
| CAS: | 118-60-5 |
| EINECS: | 204-263-4 |
| Molecular Formula: | C15H22O3 |
| Molecular Weight: | 250.34 |
| InChI: | InChI=1/C15H22O3/c1-3-5-8-12(4-2)11-18-15(17)13-9-6-7-10-14(13)16/h6-7,9-10,12,16H,3-5,8,11H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 210kgs |
| Density: | 1.014 |
| Refractive index: | 1.502 |
| Appearance: | clear to pale yellow liquid |
| Specification: |
The ethylhexanol portion of 2-Ethylhexyl salicylate (CAS NO.118-60-5) is a fatty alcohol, adding emollient and oil-like (water resistant) properties.and the salicylate portion of the molecule absorbs ultraviolet light, protecting skin from the harmful effects of exposure to sunlight. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
