| Identification | |
| Name: | 3-hydroxy-2-methyl-4-pyrone |
| Synonyms: | Maltol; Methyl maltol; 3-Hydroxy-2-methyl-4-pyron; Ehtyl Maltol |
| CAS: | 118-71-8 |
| EINECS: | 204-271-8 |
| Molecular Formula: | C6H6O3 |
| Molecular Weight: | 126.11 |
| InChI: | InChI=1/C6H6O3/c1-4-6(8)5(7)2-3-9-4/h2-3,8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.348g/cm3 |
| Stability: | Stable. |
| Refractive index: | n20/D 1.541 |
| Solubility: | 1.2 (g/100g) |
| Appearance: | White crystalline powder |
| HS Code: | 29329995 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Flavoring agent, to impart freshly bakedâ odor and flavor to bread and cakes. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
