| Identification | |
| Name: | 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-amino- |
| Synonyms: | 2,4,6-Pyrimidinetriol,5-amino- (5CI); Barbituric acid, 5-amino- (8CI); Uramil (6CI,7CI);5-Amino-2,4,6-pyrimidinetriol; 5-Amino-2,4,6-trihydroxypyrimidine;5-Amino-6-hydroxy-2,4(1H,3H)-pyrimidinedione; 5-Aminobarbituric acid;Aminobarbituric acid; Dialuramide; Murexan; NSC 264287; NSC 3971 |
| CAS: | 118-78-5 |
| EINECS: | 204-277-0 |
| Molecular Formula: | C4H5 N3 O3 |
| Molecular Weight: | 143.1 |
| InChI: | InChI=1/C4H5N3O3/c5-1-2(8)6-4(10)7-3(1)9/h1H,5H2,(H2,6,7,8,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.497g/cm3 |
| Refractive index: | 1.52 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | °C |
| Safety Data | |
 |
|
