Identification |
Name: | 2-Oxiranemethanol,2-methyl-, 2-(4-nitrobenzoate), (2S)- |
Synonyms: | Oxiranemethanol,2-methyl-, 4-nitrobenzoate, (2S)- (9CI); Oxiranemethanol, 2-methyl-,4-nitrobenzoate, (S)- |
CAS: | 118200-96-7 |
Molecular Formula: | C11H11 N O5 |
Molecular Weight: | 237.23 |
InChI: | InChI=1/C11H11NO5/c1-11(7-17-11)6-16-10(13)8-2-4-9(5-3-8)12(14)15/h2-5H,6-7H2,1H3/t11-/m1/s1 |
Molecular Structure: |
 |
Properties |
Melting Point: | 87-89 °C(lit.)
|
Flash Point: | 174°C |
Boiling Point: | 375.9°Cat760mmHg |
Density: | 1.333g/cm3 |
Refractive index: | 1.565 |
Specification: |
Oxiranemethanol, 2-methyl-, 4-nitrobenzoate, (2S)- with cas registry number of 118200-96-7 is also named as (2S)-(+)-(2,3-Epoxy-2-methylpropylester)-4-nitrobenzoate ; 2-Methyloxiranemethanol 4-nitrobenzoate (2S)- .
|
Flash Point: | 174°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |