| Identification | |
| Name: | 2H-Indol-2-one,6-chloro-5-(2-chloroethyl)-1,3-dihydro- |
| Synonyms: | 5-(2-Chloroethyl)-6-chloro-1,3-dihydro-2H-indol-2-one;5-(2-Chloroethyl)-6-chlorooxindole;6-Chloro-5-(2-chloroethyl)-2-oxoindoline;6-Chloro-5-(2-chloroethyl)indolin-2-one;6-Chloro-5-(2-chloroethyl)oxindole; |
| CAS: | 118289-55-7 |
| EINECS: | 421-320-0 |
| Molecular Formula: | C10H9Cl2NO |
| Molecular Weight: | 230.09 |
| InChI: | InChI=1/C10H9Cl2NO/c11-2-1-6-3-7-4-10(14)13-9(7)5-8(6)12/h3,5H,1-2,4H2,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 192°C |
| Boiling Point: | 393.8°Cat760mmHg |
| Density: | 1.376g/cm3 |
| Refractive index: | 1.592 |
| Specification: |
2H-Indol-2-one,6-chloro-5-(2-chloroethyl)-1,3-dihydro- , with CAS number of 118289-55-7, can be called 2H-indole-2-one,5-chloroethyl-6-chloro-1,3-dihydro ; 5-chloroethyl-6-chloro-1,3-dihydro-1h-indol-2-one ; 5-chloroethyl-6-chloro-1,3-dihydro-2h-indole-2-one ; 6-chloro-5-(2-chloroethyl)-1,3-dihydro-2h-indol-2-one ; 5-(2-chloroethyl)-1,3-dihydro-2h-6-chloroindule-2-one ; 2h-indol-2-one-6-chloro-5-(2-chloroethyl)-1,3-dihydro ; 5-chloroethyl-6-chloro-1,3-dihydro-2h-indol-2-one ; 6-chloro-5-(2-chloroethyl)-1,3 . |
| Flash Point: | 192°C |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
