| Identification |
| Name: | Cupric carbonate |
| Synonyms: | Coppercarbonate;Copper carbonate (1:1);Copper carbonate (CuCO3);Coppermonocarbonate;Cupric carbonate (1:1);Basic copper carbonate; |
| CAS: | 1184-64-1 |
| EINECS: | 214-671-4 |
| Molecular Formula: | CuCO3 |
| Molecular Weight: | 123.5549 |
| InChI: | InChI=1S/CH2O3.Cu/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
| Molecular Structure: |
 |
| Properties |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with strong acids. |
| Water Solubility: | Stability Stable. Incompatible with strong acids.Toxicology Harmful if swallowed. May be harmful if inhaled.Eye irritant. Risk phrases (The meaning of any risk phras |
| Solubility: | |
| Appearance: | green or blue powder |
| Safety Data |
| |
 |
