The N-Methyl-3-phenyl-1,2,4-oxadiazole-5-methanamine hydrochloride with the cas number 1185300-67-7 is also called N-methyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)methanamine hydrochloride. Its molecular formula is C10H11N3O.HCl. This chemical should be stored in dry and cool environment.
The properties of the chemical are: (1)ACD/LogP: 1.77; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.52; (4)ACD/LogD (pH 7.4): 1.69; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 10.77; (7)ACD/KOC (pH 5.5): 12.21; (8)ACD/KOC (pH 7.4): 180.39; (9)#H bond acceptors: 4; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 42.16Å2; (13)Enthalpy of Vaporization: 55.97 kJ/mol; (14)Vapour Pressure: 0.000366 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: Cl.n1c(onc1c2ccccc2)CNC
(2)InChI: InChI=1/C10H11N3O.ClH/c1-11-7-9-12-10(13-14-9)8-5-3-2-4-6-8;/h2-6,11H,7H2,1H3;1H
(3)InChIKey: CGMVWQUXJQHUJK-UHFFFAOYAS
|