| Identification | |
| Name: | Diaminomaleonitrile |
| Synonyms: | DAMN; 1,2-diamino-1,2-dicyanoethylene; 2,3-diamino-2-butenedinitrile |
| CAS: | 1187-42-4 |
| EINECS: | 214-697-6 |
| Molecular Formula: | C4H4N4 |
| Molecular Weight: | 108.1 |
| InChI: | InChI=1/C4H4N4/c5-1-3(7)4(8)2-6/h7-8H2/b4-3- |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3439 6 |
| Density: | 1.36 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.6 |
| Solubility: | 5 g/L (25 ºC) in water |
| Appearance: | brown crystalline powder |
| Specification: |
Diaminomaleonitrile (CAS NO.1187-42-4) is also named as 2,3-Diaminomaleonitrile ; CCRIS 921 ; Hydrogen cyanide tetramer ; NSC 266758 ; 2-Butenedinitrile, 2,3-diamino-, (2Z)- ; 2-Butenedinitrile, 2,3-diamino-, (Z)- (9CI) . Diaminomaleonitrile (CAS NO.1187-42-4) is brown crystalline powder. Diaminomaleonitrile is sensitive to prolonged exposure to air. Flash point data are not available for Diaminomaleonitrile, but it is probably combustible. |
| Packinggroup: | III |
| HS Code: | 29269095 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from light. |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
