| Identification | |
| Name: | Acetic acid,2-bromo-2-cyano-, ethyl ester |
| Synonyms: | Aceticacid, bromocyano-, ethyl ester (6CI,7CI,8CI,9CI); Ethyl 2-cyano-2-bromoacetate;Ethyl bromocyanoacetate; Ethyl cyanobromoacetate; Ethyl a-bromo-a-cyanoacetate; NSC 77072 |
| CAS: | 1187-46-8 |
| Molecular Formula: | C5H6 Br N O2 |
| Molecular Weight: | 192.03 |
| InChI: | InChI=1/C5H6BrNO2/c1-2-9-5(8)4(6)3-7/h4H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 79.9°C |
| Boiling Point: | 208.6°C at 760 mmHg |
| Density: | 1.58g/cm3 |
| Refractive index: | 1.481 |
| Specification: |
Ethyl 2-bromo-2-cyano-acetate ,its cas register number is 1187-46-8. It also can be called Ethyl alpha-bromo-alpha-cyanoacetate ; Acetic acid, bromocyano-, ethyl ester ; and Acetic acid, 2-bromo-2-cyano-, ethyl ester . |
| Flash Point: | 79.9°C |
| Safety Data | |
 |
|
