| Identification | |
| Name: | L-Cysteine, S-methyl- |
| Synonyms: | Alanine,3-(methylthio)-, L- (8CI);(-)-S-Methyl-L-cysteine;3-(Methylthio)alanine;L-S-Methylcysteine;NSC 15387;S-Methyl-(R)-cysteine;S-Methylcysteine;H-Cys(Me)-OH; |
| CAS: | 1187-84-4 |
| EINECS: | 214-701-6 |
| Molecular Formula: | C4H9NO2S |
| Molecular Weight: | 135.18 |
| InChI: | InChI=1/C4H9NO2S/c1-5-3(2-8)4(6)7/h3,5,8H,2H2,1H3,(H,6,7)/t3-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 240 oC (dec.) |
| Density: | 1.26g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -29.5 o (C=1,WATER) |
| Appearance: | Light beige. |
| Specification: |
Storage of S-Methyl-L-Cysteine (CAS NO.1187-84-4): Keep container closed when not in use. Store in a cool, dry place. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
