Identification |
Name: | L-Cysteine, S-methyl- |
Synonyms: | Alanine,3-(methylthio)-, L- (8CI);(-)-S-Methyl-L-cysteine;3-(Methylthio)alanine;L-S-Methylcysteine;NSC 15387;S-Methyl-(R)-cysteine;S-Methylcysteine;H-Cys(Me)-OH; |
CAS: | 1187-84-4 |
EINECS: | 214-701-6 |
Molecular Formula: | C4H9NO2S |
Molecular Weight: | 135.18 |
InChI: | InChI=1/C4H9NO2S/c1-5-3(2-8)4(6)7/h3,5,8H,2H2,1H3,(H,6,7)/t3-/m1/s1 |
Molecular Structure: |
 |
Properties |
Melting Point: | 240 oC (dec.) |
Density: | 1.26g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Alpha: | -29.5 o (C=1,WATER) |
Appearance: | Light beige. |
Specification: |
Storage of S-Methyl-L-Cysteine (CAS NO.1187-84-4): Keep container closed when not in use. Store in a cool, dry place.
|
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
 |