| Identification | |
| Name: | 9-amino-1,2,3,4-tetrahydroacridin-1-ol; but-2-enedioic acid |
| CAS: | 118909-22-1 |
| Molecular Formula: | C17H18N2O5 |
| Molecular Weight: | 330.34 |
| InChI: | InChI=1/C13H14N2O.C4H4O4/c14-13-8-4-1-2-5-9(8)15-10-6-3-7-11(16)12(10)13;5-3(6)1-2-4(7)8/h1-2,4-5,11,16H,3,6-7H2,(H2,14,15);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 171-173 |
| Usage: | A potential Alzheimer Disease therapeutic of low toxicity. Exhibits biochemical and pharmacological profile similar to THA except that it is far less toxic and without measurable liver toxicity in humans |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
