| Identification | |
| Name: | Phenol,4-[(2,4-dinitrophenyl)amino]- |
| Synonyms: | Phenol,p-(2,4-dinitroanilino)- (6CI,7CI,8CI); 2,4-Dinitro-4'-hydroxydiphenylamine;4-(2,4-Dinitroanilino)phenol; 4-Hydroxy-2',4'-dinitrodiphenylamine;4-[(2,4-Dinitrophenyl)amino]phenol; 4'-Hydroxy-2,4-dinitrodiphenylamine;Acetamine Yellow 2R; Acetoquinone Light Yellow 2RZ; Amacel Yellow RR; C.I.10345; C.I. Disperse Yellow 1; C.I. Solvent Yellow 52; Celliton Fast Yellow RR;Celliton Fast Yellow RRA-CF; Cilla Fast Yellow RR; Disperse Fast Yellow 2K;Disperse Yellow R; Dispersol Fast Yellow A; Dispersol Printing Yellow A;Dispersol Yellow B-A; Fast Disperse Yellow 2K; Fenacet Fast Yellow 2R; KayalonFast Yellow RR; Microsetile Yellow 2R; N-(2,4-Dinitrophenyl)-4-aminophenol; NSC13965; NSC 408078; NSC 6335; Nyloquinone Yellow 2R; Perliton Yellow RR;Permanent Yellow 2K; Reliton Yellow R; SRA Golden Yellow VIII; Serisol FastYellow A; Setacyl Yellow P-BS; Supracet Fast Yellow 2R; Supracet Yellow RR;Synten Yellow P 2R; Tulasteron Fast Yellow R-B |
| CAS: | 119-15-3 |
| EINECS: | 204-300-4 |
| Molecular Formula: | C12H9 N3 O5 |
| Molecular Weight: | 275.24 |
| InChI: | InChI=1/C12H9N3O5/c16-10-4-1-8(2-5-10)13-11-6-3-9(14(17)18)7-12(11)15(19)20/h1-7,13,16H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 4.1/PG 2 |
| Melting Point: | 191 °C (dec.)(lit.) |
| Flash Point: | 222.2°C |
| Boiling Point: | 443.8°Cat760mmHg |
| Density: | 1.549g/cm3 |
| Refractive index: | 1.726 |
| Specification: |
2,4-Dinitro-P-Hydroxydiphenylamine (CAS NO.119-15-3) is a reddish-brown solid and is an organonitrate/phenol. It insoluble in water. Organonitrate compounds range from slight to strong oxidizing agents. If mixed with reducing agents, including hydrides, sulfides and nitrides, they may begin a vigorous reaction that culminates in a detonation. The aromatic nitro compounds may explode in the presence of a base such as sodium hydroxide or potassium hydroxide even in the presence of water or organic solvents. The explosive tendencies of aromatic nitro compounds are increased by the presence of multiple nitro groups. Phenols do not behave as organic alcohols, as one might guess from the presence of a hydroxyl (-OH) group in their structure. Instead, they react as weak organic acids. Phenols and cresols are much weaker as acids than common carboxylic acids (phenol has Ka = 1.3 x 10^[-10]). These materials are incompatible with strong reducing substances such as hydrides, nitrides, alkali metals, and sulfides. Flammable gas (H2) is often generated, and the heat of the reaction may ignite the gas. Heat is also generated by the acid-base reaction between phenols and bases. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 222.2°C |
| Safety Data | |
| Hazard Symbols |
F: Flammable
Xi: Irritant
|
 |
|
