| Identification |
| Name: | 2,4-Dinitrophenylhydrazine |
| Synonyms: | DNP; 2,4-Dinitro phenyl Hydrazine |
| CAS: | 119-26-6 |
| EINECS: | 204-309-3 |
| Molecular Formula: | C6H6N4O4 |
| Molecular Weight: | 198.14 |
| InChI: | InChI=1/C6H6N4O4/c7-8-5-2-1-4(9(11)12)3-6(5)10(13)14/h1-3,8H,7H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3380 |
| Flash Point: | 182.8°C |
| Boiling Point: | 378.6°Cat760mmHg |
| Density: | 1.654g/cm3 |
| Stability: | Stable when wet, but explosive when dry. May be shock sensitive when dry. Highly flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.374 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | red powder |
| Packinggroup: | II |
| Flash Point: | 182.8°C |
| Storage Temperature: | 2-8°C |
| Safety Data |
| Hazard Symbols |
F:Flammable
Xn:Harmful
|
| |
 |
