Identification |
Name: | 2,4-Dinitrophenylhydrazine |
Synonyms: | DNP; 2,4-Dinitro phenyl Hydrazine |
CAS: | 119-26-6 |
EINECS: | 204-309-3 |
Molecular Formula: | C6H6N4O4 |
Molecular Weight: | 198.14 |
InChI: | InChI=1/C6H6N4O4/c7-8-5-2-1-4(9(11)12)3-6(5)10(13)14/h1-3,8H,7H2 |
Molecular Structure: |
![(C6H6N4O4) DNP; 2,4-Dinitro phenyl Hydrazine](https://img.guidechem.com/casimg/119-26-6.gif) |
Properties |
Transport: | UN 3380 |
Flash Point: | 182.8°C |
Boiling Point: | 378.6°Cat760mmHg |
Density: | 1.654g/cm3 |
Stability: | Stable when wet, but explosive when dry. May be shock sensitive when dry. Highly flammable. Incompatible with strong oxidizing agents. |
Refractive index: | n20/D 1.374 |
Water Solubility: | slightly soluble |
Solubility: | slightly soluble |
Appearance: | red powder |
Packinggroup: | II |
Flash Point: | 182.8°C |
Storage Temperature: | 2-8°C |
Safety Data |
Hazard Symbols |
F:Flammable
Xn:Harmful
|
|
![](/images/detail_15.png) |