| Identification | |
| Name: | Benzene,1-methoxy-2,4-dinitro- |
| Synonyms: | Anisole,2,4-dinitro- (6CI,8CI);1-Methoxy-2,4-dinitrobenzene;2,4-Dinitroanisol;2,4-Dinitroanisole;2,4-Dinitrophenyl methyl ether;Dinitroanisole;NSC 8733; |
| CAS: | 119-27-7 |
| EINECS: | 204-310-9 |
| Molecular Formula: | C7H6N2O5 |
| Molecular Weight: | 198.13 |
| InChI: | InChI=1/C7H6N2O5/c1-14-7-3-2-5(8(10)11)4-6(7)9(12)13/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 41013 |
| Flash Point: | 180.5°C |
| Density: | 1.34 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.546 (15 C) |
| Solubility: | Insoluble |
| Appearance: | Tan powder. |
| Specification: |
2,4-Dinitroanisol (119-27-7) is a yellow crystals or crystalline powder and mainly used as dye intermediate. It is soluble in alcohol and ether, slightly soluble in hot water. It is an inflammable solid. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | O51 |
| Flash Point: | 180.5°C |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
