| Identification | |
| Name: | 1(2H)-Phthalazinone |
| Synonyms: | 1-Hydroxyphthalazine;1-Oxophthalazine;1-Phthalazinol;ICX 56225770;NSC 10432;NSC 52567;Phthalazin-1-one;Phthalazinone; |
| CAS: | 119-39-1 |
| EINECS: | 204-319-8 |
| Molecular Formula: | C8H6N2O |
| Molecular Weight: | 146.15 |
| InChI: | InChI=1/C8H6N2O/c11-8-7-4-2-1-3-6(7)5-9-10-8/h1-5H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.31 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.588 |
| Solubility: | Soluble |
| Appearance: | Pale yellow crystals. |
| Specification: | Off-white to pale yellow crystalline powder Safety Statements:22-24/25-36/37/39-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29339990 |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Chemical intermediate for hydralazine, an antihypertensive agent. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
