| Identification | |
| Name: | 2H-1-Benzopyran-2-one,3,4-dihydro- |
| Synonyms: | Dihydrocoumarin;Melilotin;Melilotin (coumarin);Melilotol;Hydrocoumarin(6CI,7CI,8CI);Hydrocinnamic acid, o-hydroxy-, d-lactone (6CI);2-Chromanone;3,4-Dihydro-1H-benzopyran-2-one;3,4-Dihydro-2H-1-benzopyran-2-one; |
| CAS: | 119-84-6 |
| EINECS: | 204-354-9 |
| Molecular Formula: | C9H8O2 |
| Molecular Weight: | 148.16 |
| InChI: | InChI=1/C9H8O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-4H,5-6H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.169 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.555-1.559 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | Colorless to pale yellow clear liquid |
| Specification: | clear light yellow to brown liquid after melting Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29322980 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Leaflets White to light yellow, oily liquid Colorless crystals |
| Usage: | Fragrance in cosmetics and detergents, flavoring agent in foods & beverages. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
