| Identification | |
| Name: | o-Dianisidine |
| Synonyms: | o,o'-dianisidine; 3,3'-Dimethoxy-1,1'-Biphenyl-4,4'-Diamine; 3,3'-dimethoxy-4,4'-diaminobiphenyl; 3,3'-dianisidine; 3,3'-dimethoxybenzidine; 4,4'-diamino-3,3'-dimethoxybiphenyl; 4,4'-diamino-3,3'-biphenyldiol dimethyl ether; acetamine diazo black rd; acetamine diazo navy rd; amacel developed navy sd; azoene fast blue base; azogene fast blue b; diacelliton fast grey g; diacel navy dc; diato blue base b; diazo fast blue b; dianisidine; Blue Base; blue base irga b; blue base nb; blue bn base; brentamine fast blue b base; cellitazol b; cellitazol bn; C.I. azoic diazo component 48; C.I. Disperse Black 6; DMOB; Fast Blue; fast blue b base; fast blue dsc base; hiltonil fast blue b base; kayaku blue b base; lake blue b base; meisei teryl diazo blue hr; mitsui blue b base; naphthanil blue b base; neutrosel navy bn; setacyl diazo navy r; spectrolene blue b; |
| CAS: | 119-90-4 |
| EINECS: | 204-355-4 |
| Molecular Formula: | C14H16N2O2 |
| Molecular Weight: | 244.29 |
| InChI: | InChI=1/C14H16N2O2/c1-17-13-7-9(3-5-11(13)15)10-4-6-12(16)14(8-10)18-2/h3-8H,15-16H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 403 °F |
| Boiling Point: | 391.3°C at 760 mmHg |
| Density: | 1.178g/cm3 |
| Refractive index: | 1.618 |
| Water Solubility: | Slightly soluble. <0.01 g/100 mL at 20 C |
| Solubility: | Sol in alc, benzene, ether Sol in chloroform, acetone PROBABLY SOL IN MOST ORG SOLVENTS AND LIPIDS In water, 60 mg/l @ 25 deg C |
| Appearance: | Grey fine crystals |
| Packinggroup: | II |
| Flash Point: | 403 °F |
| Storage Temperature: | Store at RT. |
| Color: | LEAFLETS OR NEEDLES FROM WATER Colorless crystals that turn a violet color on standing. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
