| Identification |
| Name: | Ethylbenzyltoluidine |
| Synonyms: | N-Ethyl-N-(3-Methyl Phenyl)-Benzenemethanamine; N-Benzyl-N-ethyl-m-toluidine |
| CAS: | 119-94-8 |
| EINECS: | 204-359-6 |
| Molecular Formula: | C16H19N |
| Molecular Weight: | 225.33 |
| InChI: | InChI=1/C16H19N/c1-3-17(13-15-9-5-4-6-10-15)16-11-7-8-14(2)12-16/h4-12H,3,13H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2753 |
| Melting Point: | 161-162 ºC |
| Density: | 0.77 |
| Stability: | No data. |
| Refractive index: | 1.5870 |
| Water Solubility: | Insoluble SOLVENT |
| Solubility: | Insoluble SOLVENT |
| Appearance: | yellow to brown liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
