| Identification | |
| Name: | Hydrazinecarbothioamide,N-(4-methoxyphenyl)-2-[(1-methyl-1H-pyrrol-2-yl)methylene]- |
| Synonyms: | LogP |
| CAS: | 119033-87-3 |
| Molecular Formula: | C14H16 N4 O S |
| Molecular Weight: | 288.40 |
| InChI: | InChI=1/C14H16N4OS/c1-18-9-3-4-12(18)10-15-17-14(20)16-11-5-7-13(19-2)8-6-11/h3-10H,1-2H3,(H2,16,17,20)/b15-10+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 220.505°C |
| Boiling Point: | 440.994°C at 760 mmHg |
| Density: | 1.205g/cm3 |
| Refractive index: | 1.614 |
| Specification: |
4-(P-methoxyphenyl)thiosemicarbazone 1-methyl-1h-pyrrole-2-carboxaldehyde ,with CAS number of 119033-87-3,can be called Semicarbazide, 4-(p-methoxyphenyl)-1-((1-methyl-2-pyrrolyl)methylene)-3-thio- . |
| Report: |
4-(P-methoxyphenyl)thiosemicarbazone 1-methyl-1h-pyrrole-2-carboxaldehyde (CAS NO.119033-87-3) was reported in China International Book Trading Corp. |
| Flash Point: | 220.505°C |
| Safety Data | |
 |
|
