| Identification | |
| Name: | Hydrazinecarboxamide,N-(4-methoxyphenyl)-2-(1H-pyrrol-2-ylmethylene)- |
| Synonyms: | Semicarbazide, 4-(p-methoxyphenyl)-1-(2-pyrrolylmethylene)-;1H-Pyrrole-2-carboxaldehyde, 4-(p-methoxyphenyl)semicarbazone;AC1NX9AP;LS-136671;1-(4-methoxyphenyl)-3-[[(Z)-pyrrol-2-ylidenemethyl]amino]urea;Hydrazinecarboxamide, N-(4-methoxyphenyl)-2-(1H-pyrrol-2-ylmethylene)-;Hydrazinecarboxamide, N-(4-methoxyphenyl)-2-(1H-pyrrol-2-ylmethylene)- (9CI);119034-00-3 |
| CAS: | 119034-00-3 |
| Molecular Formula: | C13H14 N4 O2 |
| Molecular Weight: | 258.31 |
| InChI: | InChI=1/C13H14N4O2/c1-19-12-6-4-10(5-7-12)16-13(18)17-15-9-11-3-2-8-14-11/h2-9,15H,1H3,(H2,16,17,18)/b11-9- |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.24g/cm3 |
| Refractive index: | 1.609 |
| Specification: |
4-(P-methoxyphenyl)semicarbazone-1h-pyrrole-2-carboxaldehyde ,with CAS number of 119034-00-3,can be called Semicarbazide, 4-(p-methoxyphenyl)-1-(2-pyrrolylmethylene)- . |
| Report: |
4-(P-methoxyphenyl)semicarbazone-1h-pyrrole-2-carboxaldehyde (CAS NO.119034-00-3) was reported in China International Book Trading Corp. |
| Flash Point: | °C |
| Safety Data | |
 |
|
