Specification: |
The CAS register number of 1-Methyl-3-propylimidazolium iodide is 119171-18-5. It also can be called as 1H-Imidazolium,1-methyl-3-propyl-, iodide (1:1) and the systematic name about this chemical is 1-methyl-3-propyl-1H-imidazol-3-ium iodide. The molecular formula about this chemical is C7H13IN2 and molecular weight is 252.10. It belongs to the following product categories, such as Imidazolium Compounds; Imidazolium Salts (Ionic Liquids); Ionic Liquids; Synthetic Organic Chemistry; Chemical Synthesis; Imidazolium; Ionic Liquidsnd so on.
You can still convert the following datas into molecular structure:
(1)SMILES: [I-].CCC[n+]1ccn(C)c1
(2)InChI: InChI=1/C7H13N2.HI/c1-3-4-9-6-5-8(2)7-9;/h5-7H,3-4H2,1-2H3;1H/q+1;/p-1
(3)InChIKey: IVCMUVGRRDWTDK-REWHXWOFAY
(4)Std. InChI: InChI=1S/C7H13N2.HI/c1-3-4-9-6-5-8(2)7-9;/h5-7H,3-4H2,1-2H3;1H/q+1;/p-1
(5)Std. InChIKey: IVCMUVGRRDWTDK-UHFFFAOYSA-M
|