| Identification | |
| Name: | 1H-Pyrrole-2-carboxaldehyde,1-methyl- |
| Synonyms: | Pyrrole-2-carboxaldehyde,1-methyl- (6CI,7CI,8CI);1-Methyl-1H-pyrrole-2-carboxaldehyde;1-Methyl-2-formylpyrrole;1-Methylpyrrole-2-carboxaldehyde;2-Formyl-1-methylpyrrole;2-Formyl-N-methylpyrrole;N-Methyl-2-formylpyrrole;N-Methyl-2-pyrrolaldehyde;N-Methyl-2-pyrrolylcarboxaldehyde;N-Methylpyrrole-2-carbaldehyde;NSC 72386; |
| CAS: | 1192-58-1 |
| EINECS: | 214-755-0 |
| Molecular Formula: | C6H7NO |
| Molecular Weight: | 109.13 |
| InChI: | InChI=1/C6H7NO/c1-7-4-2-3-6(7)5-8/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 58 |
| Density: | 1.016 |
| Stability: | Stable under normal temperatures and pressures. Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.558-1.562 |
| Solubility: | Soluble |
| Appearance: | colorless - light pink - brown Liquid |
| Specification: |
1H-Pyrrole-2-carboxaldehyde,1-methyl- (CAS NO.1192-58-1), its Synonyms are 1-Methyl-1H-pyrrole-2-carboxaldehyde ; 1-Methylpyrrole-2-carbaldehyde ; 2-Formyl-1-methylpyrrole . It is clear colourless to slightlypink liquid. |
| HS Code: | 29339990 |
| Storage Temperature: | 2-8°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
