| Identification | |
| Name: | 2-Acetylfuran |
| Synonyms: | 1-(2-Furanyl)ethanone; 2-Furyl methyl ketone; 1-(2-Furyl)ethan-1-one |
| CAS: | 1192-62-7 |
| EINECS: | 214-757-1 |
| Molecular Formula: | C6H6O2 |
| Molecular Weight: | 110.11 |
| InChI: | InChI=1/C6H6O2/c1-5(7)6-3-2-4-8-6/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 2 |
| Density: | 1.098 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.506-1.508 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | Colorless to light yellow liquid |
| Specification: |
?2-Acetylfuran (CAS NO.1192-62-7), its Synonyms are 2-Furyl methyl ketone ; 2-Furyl methyl ketone (natural) ; 2-Furylethanone ; 1-(2-Furanyl)ethanone ; 1-(2-Furyl)ethanone ; Ethanone, 1-(2-furanyl)- ; FEMA No. 3163 ; Furan, 2-acetyl- ; Ketone, 2-furyl methyl ; Methyl 2-furyl ketone ; Acetylfuran . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29321900 |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
