| Identification | |
| Name: | 2-Cyclohexen-1-one,3-methyl- |
| Synonyms: | 1-Methyl-1-cyclohexen-3-one;3-Methyl-2-cyclohexen-1-one;3-Methyl-2-cyclohexene-1-one;MCH;NSC 43632;Seudenone; |
| CAS: | 1193-18-6 |
| EINECS: | 214-769-7 |
| Molecular Formula: | C7H10O |
| Molecular Weight: | 110.15 |
| InChI: | InChI=1/C7H10O/c1-6-3-2-4-7(8)5-6/h5H,2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 198 - 199 |
| Density: | 0.971 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4935-1.4955 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | Clear very slightly yellow to brown liquid |
| Specification: |
3-Methyl-2-cyclohexen-1-one (CAS NO.1193-18-6), its Synonyms are 2-Cyclohexen-1-one, 3-methyl- ; 3-Methyl-2-cyclohexenone ; MCH ; Methylcyclohexenone ; Seudenone ; 3-Methylcyclohex-2-en-1-one . |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
