Identification |
Name: | Cyclohexanemethanol, a-methyl- |
Synonyms: | (1-Hydroxyethyl)cyclohexane;1-Cyclohexane-1-ethanol;1-Cyclohexyl-1-ethanol;Cyclohexylmethylcarbinol;Ethanol, 1-cyclohexyl-;Methanol, cyclohexylmethyl-;Methylcyclohexylcarbinol;Methylcyclohexylmethanol;NSC 44898;NSC 9476;Surflot 944;a-Methylcyclohexanemethanol; |
CAS: | 1193-81-3 |
EINECS: | 214-780-7 |
Molecular Formula: | C8H16O |
Molecular Weight: | 128.21 |
InChI: | InChI=1/C8H16O/c1-7-4-2-3-5-8(7)6-9/h7-9H,2-6H2,1H3 |
Molecular Structure: |
|
Properties |
Density: | 0.928 |
Stability: | Stable at normal temperatures and pressures. |
Refractive index: | 1.465 |
Solubility: | Insoluble |
Packinggroup: | III |
HS Code: | 29061900 |
Storage Temperature: | Keep tightly closed. Keep away from heat and open flame. |
Safety Data |
Hazard Symbols |
|
|
|