| Identification |
| Name: | Cyclohexanemethanol, a-methyl- |
| Synonyms: | (1-Hydroxyethyl)cyclohexane;1-Cyclohexane-1-ethanol;1-Cyclohexyl-1-ethanol;Cyclohexylmethylcarbinol;Ethanol, 1-cyclohexyl-;Methanol, cyclohexylmethyl-;Methylcyclohexylcarbinol;Methylcyclohexylmethanol;NSC 44898;NSC 9476;Surflot 944;a-Methylcyclohexanemethanol; |
| CAS: | 1193-81-3 |
| EINECS: | 214-780-7 |
| Molecular Formula: | C8H16O |
| Molecular Weight: | 128.21 |
| InChI: | InChI=1/C8H16O/c1-7-4-2-3-5-8(7)6-9/h7-9H,2-6H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.928 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.465 |
| Solubility: | Insoluble |
| Packinggroup: | III |
| HS Code: | 29061900 |
| Storage Temperature: | Keep tightly closed. Keep away from heat and open flame. |
| Safety Data |
| Hazard Symbols |
|
| |
 |
