| Identification |
| Name: | Benzaldehyde,2,5-dihydroxy- |
| Synonyms: | Gentisaldehyde(6CI,7CI,8CI); 2,5-Dihydroxybenzaldehyde; 5-Hydroxysalicylaldehyde;Formylhydroquinone; NSC 72387 |
| CAS: | 1194-98-5 |
| EINECS: | 214-789-6 |
| Molecular Formula: | C7H6 O3 |
| Molecular Weight: | 138.12 |
| InChI: | InChI=1/C7H6O3/c8-4-5-3-6(9)1-2-7(5)10/h1-4,9-10H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.409 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.674 |
| Water Solubility: | soluble |
| Solubility: | soluble in water |
| Appearance: | yellow crystalline powder |
| Packinggroup: | I; II |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
