Identification |
Name: | 1H-Pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione,10-[(dimethylamino)methyl]-4-ethyl-4,9-dihydroxy-, hydrochloride (1:1), (4S)- |
Synonyms: | Topotecan HCl;Hycamtin;NSC 609669;Nogitecan hydrochloride;SKF 104864A;SKFS 104864A; |
CAS: | 119413-54-6 |
Molecular Formula: | C23H23N3O5.HCl |
Molecular Weight: | 457.91 |
InChI: | InChI=1/C23H23N3O5.ClH/c1-4-23(30)16-8-18-20-12(9-26(18)21(28)15(16)11-31-22(23)29)7-13-14(10-25(2)3)19(27)6-5-17(13)24-20;/h5-8,27,30H,4,9-11H2,1-3H3;1H/t23-;/m0./s1 |
Molecular Structure: |
 |
Properties |
Density: | g/cm3 |
Refractive index: | 1.733 |
Appearance: | White Crystalline Solid |
Specification: |
?Topotecan HCl (119413-54-6),also called topotecan monohydrochloride;topetecan hydrochloride;5-piperazin-1-yl-benzofuran-2-carboxylic acid ethyl ester,is white crystalline solid.
|
Usage: | Naturally occurring amino acid; precursor of tetrapyrroles in the biosynthesis of chlorophyll and heme. Antineoplastic (photosensitizer) |
Safety Data |
Hazard Symbols |
T: Toxic
|
|
 |