The CAS register number of Loureirin B is 119425-90-0. It also can be called as Propan-1-one, 1-(4-hydroxyphenyl)-3-(2,4,6-trimethoxyphenyl)- and the IUPAC name about this chemical is 1-(4-hydroxyphenyl)-3-(2,4,6-trimethoxyphenyl)propan-1-one. The molecular formula about this chemical is C18H20O5 and molecular weight is 316.35.
Physical properties about Loureirin B are: (1)ACD/LogP: 2.98; (2)ACD/LogD (pH 5.5): 2.98; (3)ACD/LogD (pH 7.4): 2.89; (4)ACD/BCF (pH 5.5): 107.88; (5)ACD/BCF (pH 7.4): 88.71; (6)ACD/KOC (pH 5.5): 991.85; (7)ACD/KOC (pH 7.4): 815.64; (8)#H bond acceptors: 5; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 8; (11)Polar Surface Area: 53.99Å2; (12)Index of Refraction: 1.563; (13)Molar Refractivity: 87.31 cm3; (14)Molar Volume: 268.6 cm3; (15)Polarizability: 34.61x10-24cm3; (16)Surface Tension: 43.3 dyne/cm; (17)Enthalpy of Vaporization: 81 kJ/mol; (18)Boiling Point: 509.9 °C at 760 mmHg; (19)Vapour Pressure: 5.12E-11 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: COC1=CC(=C(C(=C1)OC)CCC(=O)C2=CC=C(C=C2)O)OC
(2)InChI: InChI=1S/C18H20O5/c1-21-14-10-17(22-2)15(18(11-14)23-3)8-9-16(20)12-4-6-13(19)7-5-12/h4-7,10-11,19H,8-9H2,1-3H3
(3)InChIKey: ZPFRAPVRYLGYEC-UHFFFAOYSA-N
|