| Identification | |
| Name: | 2,4-Imidazolidinedione,5-ethyl-5-(phenyl-d5)- (9CI) |
| Synonyms: | rac N-Desmethyl Mephenytoin-deuterated;(+/-)-5-Ethyl-5-phenyl-deuterated-hydantoin;(+/-)-Nirvanol-D5;rac N-Desmethyl Mephenytoin-D5 (Major);((+/-)-Nirvanol-deuterated |
| CAS: | 119458-27-4 |
| Molecular Formula: | C11H7 D5 N2 O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C11H12N2O2/c1-2-11(8-6-4-3-5-7-8)9(14)12-10(15)13-11/h3-7H,2H2,1H3,(H2,12,13,14,15)/i3D,4D,5D,6D,7D |
| Molecular Structure: |  |
| Properties | |
| Refractive index: | 1.539 |
| Usage: | An anticonvulsant, hypnotic. A labelled metabolite of Mephentoin. A representative lot was 85% d5; 15% d4 1% d3 with no detectable d0 |
| Safety Data | |
 |
|
